C32H34N4O6S — CID 137131095
ethyl (5Z)-5-[[2,5-dimethyl-1-(3-nitro-4-piperidin-1-ylphenyl)pyrrol-3-yl]methylidene]-4-hydroxy-2-(4-methoxyphenyl)iminothiophene-3-carboxylate (PubChem CID 137131095) has the molecular formula C32H34N4O6S and a molecular weight of 602.71 g/mol. Its IUPAC name is ethyl (5Z)-5-[[2,5-dimethyl-1-(3-nitro-4-piperidin-1-ylphenyl)pyrrol-3-yl]methylidene]-4-hydroxy-2-(4-methoxyphenyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[2,5-dimethyl-1-(3-nitro-4-piperidin-1-ylphenyl)pyrrol-3-yl]methylidene]-4-hydroxy-2-(4-methoxyphenyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137131095 |
| Molecular Formula | C32H34N4O6S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | ethyl (5Z)-5-[[2,5-dimethyl-1-(3-nitro-4-piperidin-1-ylphenyl)pyrrol-3-yl]methylidene]-4-hydroxy-2-(4-methoxyphenyl)iminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(C)n(-c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)c2C)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C32H34N4O6S/c1-5-42-32(38)29-30(37)28(43-31(29)33-23-9-12-25(41-4)13-10-23)18-22-17-20(2)35(21(22)3)24-11-14-26(27(19-24)36(39)40)34-15-7-6-8-16-34/h9-14,17-19,37H,5-8,15-16H2,1-4H3/b28-18-,33-31- |
| InChIKey | UWYOMOCTVJWAJA-HXGGSSIYSA-N |
| XLogP | 7.19 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|