C28H28N2O3S — CID 135464812
ethyl 5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-2-(4-ethylphenyl)imino-4-hydroxythiophene-3-carboxylate (PubChem CID 135464812) has the molecular formula C28H28N2O3S and a molecular weight of 472.61 g/mol. Its IUPAC name is ethyl 5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-2-(4-ethylphenyl)imino-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl 5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-2-(4-ethylphenyl)imino-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 135464812 |
| Molecular Formula | C28H28N2O3S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | ethyl 5-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-2-(4-ethylphenyl)imino-4-hydroxythiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=Cc2cc(C)n(-c3ccccc3)c2C)S/C1=N\c1ccc(CC)cc1 |
| InChI | InChI=1S/C28H28N2O3S/c1-5-20-12-14-22(15-13-20)29-27-25(28(32)33-6-2)26(31)24(34-27)17-21-16-18(3)30(19(21)4)23-10-8-7-9-11-23/h7-17,31H,5-6H2,1-4H3/b24-17?,29-27- |
| InChIKey | RGGRVIYBUSGPOR-DMTGGRBTSA-N |
| XLogP | 6.85 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|