C31H32N4O5S — CID 137131126
ethyl (5Z)-5-[[2,5-dimethyl-1-(3-nitro-4-piperidin-1-ylphenyl)pyrrol-3-yl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 137131126) has the molecular formula C31H32N4O5S and a molecular weight of 572.69 g/mol. Its IUPAC name is ethyl (5Z)-5-[[2,5-dimethyl-1-(3-nitro-4-piperidin-1-ylphenyl)pyrrol-3-yl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[2,5-dimethyl-1-(3-nitro-4-piperidin-1-ylphenyl)pyrrol-3-yl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137131126 |
| Molecular Formula | C31H32N4O5S |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | ethyl (5Z)-5-[[2,5-dimethyl-1-(3-nitro-4-piperidin-1-ylphenyl)pyrrol-3-yl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(C)n(-c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)c2C)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C31H32N4O5S/c1-4-40-31(37)28-29(36)27(41-30(28)32-23-11-7-5-8-12-23)18-22-17-20(2)34(21(22)3)24-13-14-25(26(19-24)35(38)39)33-15-9-6-10-16-33/h5,7-8,11-14,17-19,36H,4,6,9-10,15-16H2,1-3H3/b27-18-,32-30- |
| InChIKey | CNLRJXUDWBRXFL-TYNNKJBBSA-N |
| XLogP | 7.19 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|