C31H33N5O4S — CID 4142550
3-cyclopentyl-5-[[2,5-dimethyl-1-(4-morpholin-4-yl-3-nitrophenyl)pyrrol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 4142550) has the molecular formula C31H33N5O4S and a molecular weight of 571.70 g/mol. Its IUPAC name is 3-cyclopentyl-5-[[2,5-dimethyl-1-(4-morpholin-4-yl-3-nitrophenyl)pyrrol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 3-cyclopentyl-5-[[2,5-dimethyl-1-(4-morpholin-4-yl-3-nitrophenyl)pyrrol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4142550 |
| Molecular Formula | C31H33N5O4S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | 3-cyclopentyl-5-[[2,5-dimethyl-1-(4-morpholin-4-yl-3-nitrophenyl)pyrrol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C=C2S/C(=N\c3ccccc3)N(C3CCCC3)C2=O)c(C)n1-c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H33N5O4S/c1-21-18-23(22(2)34(21)26-12-13-27(28(20-26)36(38)39)33-14-16-40-17-15-33)19-29-30(37)35(25-10-6-7-11-25)31(41-29)32-24-8-4-3-5-9-24/h3-5,8-9,12-13,18-20,25H,6-7,10-11,14-17H2,1-2H3/b29-19?,32-31- |
| InChIKey | KJVUMYJFHOGSDX-SMVZRNHDSA-N |
| XLogP | 6.39 |
| TPSA | 93.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|