C30H29ClN4O6S — CID 137126924
ethyl (5Z)-2-(4-chlorophenyl)imino-5-[[2,5-dimethyl-1-(4-morpholin-4-yl-3-nitrophenyl)pyrrol-3-yl]methylidene]-4-hydroxythiophene-3-carboxylate (PubChem CID 137126924) has the molecular formula C30H29ClN4O6S and a molecular weight of 609.10 g/mol. Its IUPAC name is ethyl (5Z)-2-(4-chlorophenyl)imino-5-[[2,5-dimethyl-1-(4-morpholin-4-yl-3-nitrophenyl)pyrrol-3-yl]methylidene]-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-(4-chlorophenyl)imino-5-[[2,5-dimethyl-1-(4-morpholin-4-yl-3-nitrophenyl)pyrrol-3-yl]methylidene]-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 137126924 |
| Molecular Formula | C30H29ClN4O6S |
| Molecular Weight | 609.10 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | ethyl (5Z)-2-(4-chlorophenyl)imino-5-[[2,5-dimethyl-1-(4-morpholin-4-yl-3-nitrophenyl)pyrrol-3-yl]methylidene]-4-hydroxythiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(C)n(-c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)c2C)S/C1=N\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H29ClN4O6S/c1-4-41-30(37)27-28(36)26(42-29(27)32-22-7-5-21(31)6-8-22)16-20-15-18(2)34(19(20)3)23-9-10-24(25(17-23)35(38)39)33-11-13-40-14-12-33/h5-10,15-17,36H,4,11-14H2,1-3H3/b26-16-,32-29- |
| InChIKey | YMCTUCFSVKACDK-SHKHLXLWSA-N |
| XLogP | 6.69 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.10 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|