C29H30N2O3S — CID 135507147
ethyl 5-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]-2-(4-ethylphenyl)imino-4-hydroxythiophene-3-carboxylate (PubChem CID 135507147) has the molecular formula C29H30N2O3S and a molecular weight of 486.64 g/mol. Its IUPAC name is ethyl 5-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]-2-(4-ethylphenyl)imino-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl 5-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]-2-(4-ethylphenyl)imino-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 135507147 |
| Molecular Formula | C29H30N2O3S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | ethyl 5-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]-2-(4-ethylphenyl)imino-4-hydroxythiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=Cc2cc(C)n(-c3cccc(C)c3)c2C)S/C1=N\c1ccc(CC)cc1 |
| InChI | InChI=1S/C29H30N2O3S/c1-6-21-11-13-23(14-12-21)30-28-26(29(33)34-7-2)27(32)25(35-28)17-22-16-19(4)31(20(22)5)24-10-8-9-18(3)15-24/h8-17,32H,6-7H2,1-5H3/b25-17?,30-28- |
| InChIKey | KOKNNRSEMJKMQX-WHWJCEGFSA-N |
| XLogP | 7.16 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|