C27H33N3O2S — CID 126212457
(5Z)-3-cyclohexyl-5-[[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126212457) has the molecular formula C27H33N3O2S and a molecular weight of 463.65 g/mol. Its IUPAC name is (5Z)-3-cyclohexyl-5-[[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-cyclohexyl-5-[[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126212457 |
| Molecular Formula | C27H33N3O2S |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (5Z)-3-cyclohexyl-5-[[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(/C=C2\S/C(=N\c3ccccc3)N(C3CCCCC3)C2=O)c(C)n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C27H33N3O2S/c1-19-16-21(20(2)29(19)18-24-14-9-15-32-24)17-25-26(31)30(23-12-7-4-8-13-23)27(33-25)28-22-10-5-3-6-11-22/h3,5-6,10-11,16-17,23-24H,4,7-9,12-15,18H2,1-2H3/b25-17-,28-27-/t24-/m1/s1 |
| InChIKey | NIOXBKZCIWXSNZ-AVCIQGLISA-N |
| XLogP | 6.22 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|