C29H32N4O3S — CID 126139507
(5Z)-3-(3,4-dimethylphenyl)-5-[[7-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126139507) has the molecular formula C29H32N4O3S and a molecular weight of 516.67 g/mol. Its IUPAC name is (5Z)-3-(3,4-dimethylphenyl)-5-[[7-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-(3,4-dimethylphenyl)-5-[[7-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126139507 |
| Molecular Formula | C29H32N4O3S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | (5Z)-3-(3,4-dimethylphenyl)-5-[[7-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCc1cccc2c(/C=C3/C(=O)N(c4ccc(C)c(C)c4)C(=S)N3C)cn(CC(=O)N3CCOCC3)c12 |
| InChI | InChI=1S/C29H32N4O3S/c1-5-21-7-6-8-24-22(17-32(27(21)24)18-26(34)31-11-13-36-14-12-31)16-25-28(35)33(29(37)30(25)4)23-10-9-19(2)20(3)15-23/h6-10,15-17H,5,11-14,18H2,1-4H3/b25-16- |
| InChIKey | MXWOIARLRCFBLI-XYGWBWBKSA-N |
| XLogP | 4.28 |
| TPSA | 58.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|