C22H24BrN3O2S2 — CID 126137227
(5Z)-5-[[1-(3-bromo-4-morpholin-4-ylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126137227) has the molecular formula C22H24BrN3O2S2 and a molecular weight of 506.49 g/mol. Its IUPAC name is (5Z)-5-[[1-(3-bromo-4-morpholin-4-ylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-(3-bromo-4-morpholin-4-ylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126137227 |
| Molecular Formula | C22H24BrN3O2S2 |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | (5Z)-5-[[1-(3-bromo-4-morpholin-4-ylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2cc(C)n(-c3ccc(N4CCOCC4)c(Br)c3)c2C)SC1=S |
| InChI | InChI=1S/C22H24BrN3O2S2/c1-4-25-21(27)20(30-22(25)29)12-16-11-14(2)26(15(16)3)17-5-6-19(18(23)13-17)24-7-9-28-10-8-24/h5-6,11-13H,4,7-10H2,1-3H3/b20-12- |
| InChIKey | XGVDLQKJYJFKHW-NDENLUEZSA-N |
| XLogP | 4.91 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|