C11H14N2O3 — CID 136904662
4-[(Z)-morpholin-4-yliminomethyl]benzene-1,3-diol (PubChem CID 136904662) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 4-[(Z)-morpholin-4-yliminomethyl]benzene-1,3-diol.
| Compound Name | 4-[(Z)-morpholin-4-yliminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136904662 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 4-[(Z)-morpholin-4-yliminomethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C=N\N2CCOCC2)c(O)c1 |
| InChI | InChI=1S/C11H14N2O3/c14-10-2-1-9(11(15)7-10)8-12-13-3-5-16-6-4-13/h1-2,7-8,14-15H,3-6H2/b12-8- |
| InChIKey | JTRITFLEVNBQEG-WQLSENKSSA-N |
| XLogP | 0.76 |
| TPSA | 65.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|