C12H16N2O2 — CID 135684063
4-[(E)-piperidin-1-yliminomethyl]benzene-1,3-diol (PubChem CID 135684063) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 4-[(E)-piperidin-1-yliminomethyl]benzene-1,3-diol.
| Compound Name | 4-[(E)-piperidin-1-yliminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135684063 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 4-[(E)-piperidin-1-yliminomethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C=N/N2CCCCC2)c(O)c1 |
| InChI | InChI=1S/C12H16N2O2/c15-11-5-4-10(12(16)8-11)9-13-14-6-2-1-3-7-14/h4-5,8-9,15-16H,1-3,6-7H2/b13-9+ |
| InChIKey | OMCGXNKKRGGPCS-UKTHLTGXSA-N |
| XLogP | 1.92 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|