C23H28ClN3 — CID 5192296
N-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 5192296) has the molecular formula C23H28ClN3 and a molecular weight of 381.95 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
| Compound Name | N-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 5192296 |
| Molecular Formula | C23H28ClN3 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | N-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | Cc1cc(C=NN=C2CC3CCC2(C)C3(C)C)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H28ClN3/c1-15-12-17(16(2)27(15)20-8-6-19(24)7-9-20)14-25-26-21-13-18-10-11-23(21,5)22(18,3)4/h6-9,12,14,18H,10-11,13H2,1-5H3 |
| InChIKey | SQSMXMWNOZGVLI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|