C18H17ClN4O3S — CID 135479102
2-[2-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135479102) has the molecular formula C18H17ClN4O3S and a molecular weight of 404.88 g/mol. Its IUPAC name is 2-[2-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135479102 |
| Molecular Formula | C18H17ClN4O3S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-[2-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | Cc1cc(C=NN=C2NC(=O)C(CC(=O)O)S2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN4O3S/c1-10-7-12(11(2)23(10)14-5-3-13(19)4-6-14)9-20-22-18-21-17(26)15(27-18)8-16(24)25/h3-7,9,15H,8H2,1-2H3,(H,24,25)(H,21,22,26) |
| InChIKey | YEWGBFUXFOUMRY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|