C12H10BF2N3O5S — CID 168622554
2-[2-[(2-borono-4,5-difluorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168622554) has the molecular formula C12H10BF2N3O5S and a molecular weight of 357.10 g/mol. Its IUPAC name is 2-[2-[(2-borono-4,5-difluorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(2-borono-4,5-difluorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168622554 |
| Molecular Formula | C12H10BF2N3O5S |
| Molecular Weight | 357.10 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-[2-[(2-borono-4,5-difluorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2cc(F)c(F)cc2B(O)O)NC1=O |
| InChI | InChI=1S/C12H10BF2N3O5S/c14-7-1-5(6(13(22)23)2-8(7)15)4-16-18-12-17-11(21)9(24-12)3-10(19)20/h1-2,4,9,22-23H,3H2,(H,19,20)(H,17,18,21) |
| InChIKey | MEZBBZRXVXDHPK-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 131.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.10 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|