C13H9F4N3O4S — CID 168622377
2-[2-[[4-fluoro-2-hydroxy-5-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168622377) has the molecular formula C13H9F4N3O4S and a molecular weight of 379.29 g/mol. Its IUPAC name is 2-[2-[[4-fluoro-2-hydroxy-5-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[4-fluoro-2-hydroxy-5-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168622377 |
| Molecular Formula | C13H9F4N3O4S |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 2-[2-[[4-fluoro-2-hydroxy-5-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2cc(C(F)(F)F)c(F)cc2O)NC1=O |
| InChI | InChI=1S/C13H9F4N3O4S/c14-7-2-8(21)5(1-6(7)13(15,16)17)4-18-20-12-19-11(24)9(25-12)3-10(22)23/h1-2,4,9,21H,3H2,(H,22,23)(H,19,20,24) |
| InChIKey | ZNJGYMUHBQQOEL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|