C13H10F3N3O5S — CID 168622126
2-[2-[[2-hydroxy-4-(trifluoromethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168622126) has the molecular formula C13H10F3N3O5S and a molecular weight of 377.30 g/mol. Its IUPAC name is 2-[2-[[2-hydroxy-4-(trifluoromethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[2-hydroxy-4-(trifluoromethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168622126 |
| Molecular Formula | C13H10F3N3O5S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2-[2-[[2-hydroxy-4-(trifluoromethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2ccc(OC(F)(F)F)cc2O)NC1=O |
| InChI | InChI=1S/C13H10F3N3O5S/c14-13(15,16)24-7-2-1-6(8(20)3-7)5-17-19-12-18-11(23)9(25-12)4-10(21)22/h1-3,5,9,20H,4H2,(H,21,22)(H,18,19,23) |
| InChIKey | JWPHSMGQQVNZAL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|