C12H8BrFIN3O3S — CID 168622563
2-[2-[(4-bromo-2-fluoro-5-iodophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168622563) has the molecular formula C12H8BrFIN3O3S and a molecular weight of 500.09 g/mol. Its IUPAC name is 2-[2-[(4-bromo-2-fluoro-5-iodophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(4-bromo-2-fluoro-5-iodophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168622563 |
| Molecular Formula | C12H8BrFIN3O3S |
| Molecular Weight | 500.09 g/mol |
| Exact Mass | 498.85 |
| IUPAC Name | 2-[2-[(4-bromo-2-fluoro-5-iodophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2cc(I)c(Br)cc2F)NC1=O |
| InChI | InChI=1S/C12H8BrFIN3O3S/c13-6-2-7(14)5(1-8(6)15)4-16-18-12-17-11(21)9(22-12)3-10(19)20/h1-2,4,9H,3H2,(H,19,20)(H,17,18,21) |
| InChIKey | CUMOLLRQXXWMDW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.09 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|