C13H11FIN3O4S — CID 168622439
2-[2-[(3-fluoro-4-iodo-2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168622439) has the molecular formula C13H11FIN3O4S and a molecular weight of 451.22 g/mol. Its IUPAC name is 2-[2-[(3-fluoro-4-iodo-2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(3-fluoro-4-iodo-2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168622439 |
| Molecular Formula | C13H11FIN3O4S |
| Molecular Weight | 451.22 g/mol |
| Exact Mass | 450.95 |
| IUPAC Name | 2-[2-[(3-fluoro-4-iodo-2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1c(C=NN=C2NC(=O)C(CC(=O)O)S2)ccc(I)c1F |
| InChI | InChI=1S/C13H11FIN3O4S/c1-22-11-6(2-3-7(15)10(11)14)5-16-18-13-17-12(21)8(23-13)4-9(19)20/h2-3,5,8H,4H2,1H3,(H,19,20)(H,17,18,21) |
| InChIKey | HYBRSPBARSWPTD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|