C13H10F3N3O4S — CID 168621269
2-[4-oxo-2-[(2,4,6-trifluoro-3-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168621269) has the molecular formula C13H10F3N3O4S and a molecular weight of 361.30 g/mol. Its IUPAC name is 2-[4-oxo-2-[(2,4,6-trifluoro-3-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[4-oxo-2-[(2,4,6-trifluoro-3-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168621269 |
| Molecular Formula | C13H10F3N3O4S |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-[4-oxo-2-[(2,4,6-trifluoro-3-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1c(F)cc(F)c(C=NN=C2NC(=O)C(CC(=O)O)S2)c1F |
| InChI | InChI=1S/C13H10F3N3O4S/c1-23-11-7(15)2-6(14)5(10(11)16)4-17-19-13-18-12(22)8(24-13)3-9(20)21/h2,4,8H,3H2,1H3,(H,20,21)(H,18,19,22) |
| InChIKey | UXQFPXJMNFPAKS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|