C13H11Br2N3O4S — CID 168622071
2-[2-[(2,4-dibromo-5-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168622071) has the molecular formula C13H11Br2N3O4S and a molecular weight of 465.12 g/mol. Its IUPAC name is 2-[2-[(2,4-dibromo-5-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(2,4-dibromo-5-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168622071 |
| Molecular Formula | C13H11Br2N3O4S |
| Molecular Weight | 465.12 g/mol |
| Exact Mass | 462.88 |
| IUPAC Name | 2-[2-[(2,4-dibromo-5-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1cc(C=NN=C2NC(=O)C(CC(=O)O)S2)c(Br)cc1Br |
| InChI | InChI=1S/C13H11Br2N3O4S/c1-22-9-2-6(7(14)3-8(9)15)5-16-18-13-17-12(21)10(23-13)4-11(19)20/h2-3,5,10H,4H2,1H3,(H,19,20)(H,17,18,21) |
| InChIKey | DAZYEWKYACPPNP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|