C14H14BrN3O5S — CID 135479110
2-[2-[(2-bromo-4,5-dimethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135479110) has the molecular formula C14H14BrN3O5S and a molecular weight of 416.25 g/mol. Its IUPAC name is 2-[2-[(2-bromo-4,5-dimethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(2-bromo-4,5-dimethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135479110 |
| Molecular Formula | C14H14BrN3O5S |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | 2-[2-[(2-bromo-4,5-dimethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1cc(Br)c(C=NN=C2NC(=O)C(CC(=O)O)S2)cc1OC |
| InChI | InChI=1S/C14H14BrN3O5S/c1-22-9-3-7(8(15)4-10(9)23-2)6-16-18-14-17-13(21)11(24-14)5-12(19)20/h3-4,6,11H,5H2,1-2H3,(H,19,20)(H,17,18,21) |
| InChIKey | SNLYWTGNJQVMDG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|