C34H32N8 — CID 138398899
1-N,4-N-bis[(E)-(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-2,3-dihydrophthalazine-1,4-diimine (PubChem CID 138398899) has the molecular formula C34H32N8 and a molecular weight of 552.69 g/mol. Its IUPAC name is 1-N,4-N-bis[(E)-(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-2,3-dihydrophthalazine-1,4-diimine.
| Compound Name | 1-N,4-N-bis[(E)-(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-2,3-dihydrophthalazine-1,4-diimine |
|---|---|
| PubChem CID | 138398899 |
| Molecular Formula | C34H32N8 |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 1-N,4-N-bis[(E)-(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-2,3-dihydrophthalazine-1,4-diimine |
| SMILES | Cc1cc(/C=N/N=c2\[nH][nH]/c(=N/N=C/c3cc(C)n(-c4ccccc4)c3C)c3ccccc23)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C34H32N8/c1-23-19-27(25(3)41(23)29-13-7-5-8-14-29)21-35-37-33-31-17-11-12-18-32(31)34(40-39-33)38-36-22-28-20-24(2)42(26(28)4)30-15-9-6-10-16-30/h5-22H,1-4H3,(H,37,39)(H,38,40)/b35-21+,36-22+ |
| InChIKey | KENGDGAFHQXMES-JTOYJDTJSA-N |
| XLogP | 6.18 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|