C22H19N3 — CID 793172
1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-quinolin-6-ylmethanimine (PubChem CID 793172) has the molecular formula C22H19N3 and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-quinolin-6-ylmethanimine.
| Compound Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-quinolin-6-ylmethanimine |
|---|---|
| PubChem CID | 793172 |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-quinolin-6-ylmethanimine |
| SMILES | Cc1cc(/C=N/c2ccc3ncccc3c2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H19N3/c1-16-13-19(17(2)25(16)21-8-4-3-5-9-21)15-24-20-10-11-22-18(14-20)7-6-12-23-22/h3-15H,1-2H3/b24-15+ |
| InChIKey | SQOYNCWBIPYBTF-BUVRLJJBSA-N |
| XLogP | 5.39 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|