C23H18N4 — CID 23961215
4-[(2,5-dimethyl-1-quinolin-6-ylpyrrol-3-yl)methylideneamino]benzonitrile (PubChem CID 23961215) has the molecular formula C23H18N4 and a molecular weight of 350.43 g/mol. Its IUPAC name is 4-[(2,5-dimethyl-1-quinolin-6-ylpyrrol-3-yl)methylideneamino]benzonitrile.
| Compound Name | 4-[(2,5-dimethyl-1-quinolin-6-ylpyrrol-3-yl)methylideneamino]benzonitrile |
|---|---|
| PubChem CID | 23961215 |
| Molecular Formula | C23H18N4 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-[(2,5-dimethyl-1-quinolin-6-ylpyrrol-3-yl)methylideneamino]benzonitrile |
| SMILES | Cc1cc(/C=N/c2ccc(C#N)cc2)c(C)n1-c1ccc2ncccc2c1 |
| InChI | InChI=1S/C23H18N4/c1-16-12-20(15-26-21-7-5-18(14-24)6-8-21)17(2)27(16)22-9-10-23-19(13-22)4-3-11-25-23/h3-13,15H,1-2H3/b26-15+ |
| InChIKey | WHZFAZVEZLKUFZ-CVKSISIWSA-N |
| XLogP | 5.26 |
| TPSA | 53.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|