C25H19N5O3S — CID 4996342
N-[(2,5-dimethyl-1-quinolin-6-ylpyrrol-3-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 4996342) has the molecular formula C25H19N5O3S and a molecular weight of 469.53 g/mol. Its IUPAC name is N-[(2,5-dimethyl-1-quinolin-6-ylpyrrol-3-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(2,5-dimethyl-1-quinolin-6-ylpyrrol-3-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4996342 |
| Molecular Formula | C25H19N5O3S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | N-[(2,5-dimethyl-1-quinolin-6-ylpyrrol-3-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1cc(C=NNC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)c(C)n1-c1ccc2ncccc2c1 |
| InChI | InChI=1S/C25H19N5O3S/c1-15-10-19(16(2)29(15)20-5-7-22-17(11-20)4-3-9-26-22)14-27-28-25(31)24-13-18-12-21(30(32)33)6-8-23(18)34-24/h3-14H,1-2H3,(H,28,31) |
| InChIKey | MJSQRXGTDPAMLB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|