C22H16Cl2N4O3S — CID 4313406
N-[[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 4313406) has the molecular formula C22H16Cl2N4O3S and a molecular weight of 487.37 g/mol. Its IUPAC name is N-[[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4313406 |
| Molecular Formula | C22H16Cl2N4O3S |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | N-[[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1cc(C=NNC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)c(C)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H16Cl2N4O3S/c1-12-8-15(13(2)27(12)18-5-3-4-17(23)21(18)24)11-25-26-22(29)20-10-14-9-16(28(30)31)6-7-19(14)32-20/h3-11H,1-2H3,(H,26,29) |
| InChIKey | GJDSJEALWFQYEI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|