C19H18BrN3 — CID 126235790
N-(4-bromo-3-methylphenyl)-1-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanimine (PubChem CID 126235790) has the molecular formula C19H18BrN3 and a molecular weight of 368.28 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-1-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanimine.
| Compound Name | N-(4-bromo-3-methylphenyl)-1-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanimine |
|---|---|
| PubChem CID | 126235790 |
| Molecular Formula | C19H18BrN3 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-1-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanimine |
| SMILES | Cc1cc(/N=C/c2cc(C)n(-c3ccccn3)c2C)ccc1Br |
| InChI | InChI=1S/C19H18BrN3/c1-13-10-17(7-8-18(13)20)22-12-16-11-14(2)23(15(16)3)19-6-4-5-9-21-19/h4-12H,1-3H3/b22-12+ |
| InChIKey | RQTKIPFLIAUWQQ-WSDLNYQXSA-N |
| XLogP | 5.31 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|