C15H21NO3 — CID 112695840
6-[(3-propylpyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol (PubChem CID 112695840) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 6-[(3-propylpyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(3-propylpyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 112695840 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 6-[(3-propylpyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol |
| SMILES | CCCC1CCN(Cc2cc3c(cc2O)OCO3)C1 |
| InChI | InChI=1S/C15H21NO3/c1-2-3-11-4-5-16(8-11)9-12-6-14-15(7-13(12)17)19-10-18-14/h6-7,11,17H,2-5,8-10H2,1H3 |
| InChIKey | RNCXXXLYIDHYIT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|