C29H28FN3O5 — CID 26277146
2-[2-(3-fluorophenyl)ethyl]-4-[4-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 26277146) has the molecular formula C29H28FN3O5 and a molecular weight of 517.56 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)ethyl]-4-[4-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-fluorophenyl)ethyl]-4-[4-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 26277146 |
| Molecular Formula | C29H28FN3O5 |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 2-[2-(3-fluorophenyl)ethyl]-4-[4-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1cc(CN2CCN(c3cccc4c3C(=O)N(CCc3cccc(F)c3)C4=O)CC2)cc2c1OCO2 |
| InChI | InChI=1S/C29H28FN3O5/c1-36-24-15-20(16-25-27(24)38-18-37-25)17-31-10-12-32(13-11-31)23-7-3-6-22-26(23)29(35)33(28(22)34)9-8-19-4-2-5-21(30)14-19/h2-7,14-16H,8-13,17-18H2,1H3 |
| InChIKey | ZSVSZOQXGGHDNQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|