C29H28F3N3O4 — CID 45181090
4-[4-[(3,5-dimethoxyphenyl)methyl]piperazin-1-yl]-2-[[4-(trifluoromethyl)phenyl]methyl]isoindole-1,3-dione (PubChem CID 45181090) has the molecular formula C29H28F3N3O4 and a molecular weight of 539.55 g/mol. Its IUPAC name is 4-[4-[(3,5-dimethoxyphenyl)methyl]piperazin-1-yl]-2-[[4-(trifluoromethyl)phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 4-[4-[(3,5-dimethoxyphenyl)methyl]piperazin-1-yl]-2-[[4-(trifluoromethyl)phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45181090 |
| Molecular Formula | C29H28F3N3O4 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 4-[4-[(3,5-dimethoxyphenyl)methyl]piperazin-1-yl]-2-[[4-(trifluoromethyl)phenyl]methyl]isoindole-1,3-dione |
| SMILES | COc1cc(CN2CCN(c3cccc4c3C(=O)N(Cc3ccc(C(F)(F)F)cc3)C4=O)CC2)cc(OC)c1 |
| InChI | InChI=1S/C29H28F3N3O4/c1-38-22-14-20(15-23(16-22)39-2)17-33-10-12-34(13-11-33)25-5-3-4-24-26(25)28(37)35(27(24)36)18-19-6-8-21(9-7-19)29(30,31)32/h3-9,14-16H,10-13,17-18H2,1-2H3 |
| InChIKey | PBPTUUNSAGQIOE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|