C27H28F3N3O2 — CID 45230835
4-[4-(cyclohex-3-en-1-ylmethyl)piperazin-1-yl]-2-[[4-(trifluoromethyl)phenyl]methyl]isoindole-1,3-dione (PubChem CID 45230835) has the molecular formula C27H28F3N3O2 and a molecular weight of 483.53 g/mol. Its IUPAC name is 4-[4-(cyclohex-3-en-1-ylmethyl)piperazin-1-yl]-2-[[4-(trifluoromethyl)phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 4-[4-(cyclohex-3-en-1-ylmethyl)piperazin-1-yl]-2-[[4-(trifluoromethyl)phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45230835 |
| Molecular Formula | C27H28F3N3O2 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 4-[4-(cyclohex-3-en-1-ylmethyl)piperazin-1-yl]-2-[[4-(trifluoromethyl)phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(N3CCN(CC4CC=CCC4)CC3)c2C(=O)N1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H28F3N3O2/c28-27(29,30)21-11-9-20(10-12-21)18-33-25(34)22-7-4-8-23(24(22)26(33)35)32-15-13-31(14-16-32)17-19-5-2-1-3-6-19/h1-2,4,7-12,19H,3,5-6,13-18H2 |
| InChIKey | GYUWCCBFKGHVJU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|