C23H18N2O4S — CID 127253763
3,4-dimethoxy-6-[(2-methyl-1,3-thiazol-4-yl)methyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 127253763) has the molecular formula C23H18N2O4S and a molecular weight of 418.47 g/mol. Its IUPAC name is 3,4-dimethoxy-6-[(2-methyl-1,3-thiazol-4-yl)methyl]indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 3,4-dimethoxy-6-[(2-methyl-1,3-thiazol-4-yl)methyl]indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 127253763 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 3,4-dimethoxy-6-[(2-methyl-1,3-thiazol-4-yl)methyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1ccc2c3c(n(Cc4csc(C)n4)c(=O)c2c1OC)-c1ccccc1C3=O |
| InChI | InChI=1S/C23H18N2O4S/c1-12-24-13(11-30-12)10-25-20-14-6-4-5-7-15(14)21(26)18(20)16-8-9-17(28-2)22(29-3)19(16)23(25)27/h4-9,11H,10H2,1-3H3 |
| InChIKey | TVNRALOXKWYLSG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|