C28H22N2O4 — CID 127253441
6-(2-indol-1-ylethyl)-3,4-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 127253441) has the molecular formula C28H22N2O4 and a molecular weight of 450.49 g/mol. Its IUPAC name is 6-(2-indol-1-ylethyl)-3,4-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-(2-indol-1-ylethyl)-3,4-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 127253441 |
| Molecular Formula | C28H22N2O4 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 6-(2-indol-1-ylethyl)-3,4-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1ccc2c3c(n(CCn4ccc5ccccc54)c(=O)c2c1OC)-c1ccccc1C3=O |
| InChI | InChI=1S/C28H22N2O4/c1-33-22-12-11-20-23-25(18-8-4-5-9-19(18)26(23)31)30(28(32)24(20)27(22)34-2)16-15-29-14-13-17-7-3-6-10-21(17)29/h3-14H,15-16H2,1-2H3 |
| InChIKey | AOAAFWMGMPOWCR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|