C20H23NO4 — CID 141115136
1-[3-(3,4,5-trimethoxyphenoxy)propyl]indole (PubChem CID 141115136) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[3-(3,4,5-trimethoxyphenoxy)propyl]indole.
| Compound Name | 1-[3-(3,4,5-trimethoxyphenoxy)propyl]indole |
|---|---|
| PubChem CID | 141115136 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-[3-(3,4,5-trimethoxyphenoxy)propyl]indole |
| SMILES | COc1cc(OCCCn2ccc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C20H23NO4/c1-22-18-13-16(14-19(23-2)20(18)24-3)25-12-6-10-21-11-9-15-7-4-5-8-17(15)21/h4-5,7-9,11,13-14H,6,10,12H2,1-3H3 |
| InChIKey | PJJLCYPVJAIPGD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|