C18H18INO3 — CID 11247248
1-[(2-iodo-3,4,5-trimethoxyphenyl)methyl]indole (PubChem CID 11247248) has the molecular formula C18H18INO3 and a molecular weight of 423.25 g/mol. Its IUPAC name is 1-[(2-iodo-3,4,5-trimethoxyphenyl)methyl]indole.
| Compound Name | 1-[(2-iodo-3,4,5-trimethoxyphenyl)methyl]indole |
|---|---|
| PubChem CID | 11247248 |
| Molecular Formula | C18H18INO3 |
| Molecular Weight | 423.25 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 1-[(2-iodo-3,4,5-trimethoxyphenyl)methyl]indole |
| SMILES | COc1cc(Cn2ccc3ccccc32)c(I)c(OC)c1OC |
| InChI | InChI=1S/C18H18INO3/c1-21-15-10-13(16(19)18(23-3)17(15)22-2)11-20-9-8-12-6-4-5-7-14(12)20/h4-10H,11H2,1-3H3 |
| InChIKey | ABQPEOJNKYWETH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|