C19H18N2O — CID 11162092
2-[4-(3-indol-1-ylpropoxy)phenyl]acetonitrile (PubChem CID 11162092) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[4-(3-indol-1-ylpropoxy)phenyl]acetonitrile.
| Compound Name | 2-[4-(3-indol-1-ylpropoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 11162092 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-[4-(3-indol-1-ylpropoxy)phenyl]acetonitrile |
| SMILES | N#CCc1ccc(OCCCn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C19H18N2O/c20-12-10-16-6-8-18(9-7-16)22-15-3-13-21-14-11-17-4-1-2-5-19(17)21/h1-2,4-9,11,14H,3,10,13,15H2 |
| InChIKey | CIXLVKMOTQSKEZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|