C27H21N3O6 — CID 127253269
4-[[2-(3,4-dimethoxy-5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)acetyl]amino]benzamide (PubChem CID 127253269) has the molecular formula C27H21N3O6 and a molecular weight of 483.48 g/mol. Its IUPAC name is 4-[[2-(3,4-dimethoxy-5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)acetyl]amino]benzamide.
| Compound Name | 4-[[2-(3,4-dimethoxy-5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 127253269 |
| Molecular Formula | C27H21N3O6 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 4-[[2-(3,4-dimethoxy-5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)acetyl]amino]benzamide |
| SMILES | COc1ccc2c3c(n(CC(=O)Nc4ccc(C(N)=O)cc4)c(=O)c2c1OC)-c1ccccc1C3=O |
| InChI | InChI=1S/C27H21N3O6/c1-35-19-12-11-18-21-23(16-5-3-4-6-17(16)24(21)32)30(27(34)22(18)25(19)36-2)13-20(31)29-15-9-7-14(8-10-15)26(28)33/h3-12H,13H2,1-2H3,(H2,28,33)(H,29,31) |
| InChIKey | CIHYTDDFHVYNAY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|