C24H19NO4 — CID 141068273
4-(1,3-benzodioxol-5-yl)-1-[(4-methoxyphenyl)methyl]quinolin-2-one (PubChem CID 141068273) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-1-[(4-methoxyphenyl)methyl]quinolin-2-one.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-1-[(4-methoxyphenyl)methyl]quinolin-2-one |
|---|---|
| PubChem CID | 141068273 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-1-[(4-methoxyphenyl)methyl]quinolin-2-one |
| SMILES | COc1ccc(Cn2c(=O)cc(-c3ccc4c(c3)OCO4)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H19NO4/c1-27-18-9-6-16(7-10-18)14-25-21-5-3-2-4-19(21)20(13-24(25)26)17-8-11-22-23(12-17)29-15-28-22/h2-13H,14-15H2,1H3 |
| InChIKey | KVJGXYQPFLQVBV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |