C26H25NO4 — CID 18735551
3-(1,3-benzodioxol-5-yl)-1-benzyl-5-(4-methoxyphenyl)piperidin-4-one (PubChem CID 18735551) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-benzyl-5-(4-methoxyphenyl)piperidin-4-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-benzyl-5-(4-methoxyphenyl)piperidin-4-one |
|---|---|
| PubChem CID | 18735551 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-benzyl-5-(4-methoxyphenyl)piperidin-4-one |
| SMILES | COc1ccc(C2CN(Cc3ccccc3)CC(c3ccc4c(c3)OCO4)C2=O)cc1 |
| InChI | InChI=1S/C26H25NO4/c1-29-21-10-7-19(8-11-21)22-15-27(14-18-5-3-2-4-6-18)16-23(26(22)28)20-9-12-24-25(13-20)31-17-30-24/h2-13,22-23H,14-17H2,1H3 |
| InChIKey | ZWMDUMCJYPMOQW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |