C29H30N2O4 — CID 139956939
7-methoxy-4-(4-methoxyphenyl)-1-[(4-piperidin-4-yloxyphenyl)methyl]quinolin-2-one (PubChem CID 139956939) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is 7-methoxy-4-(4-methoxyphenyl)-1-[(4-piperidin-4-yloxyphenyl)methyl]quinolin-2-one.
| Compound Name | 7-methoxy-4-(4-methoxyphenyl)-1-[(4-piperidin-4-yloxyphenyl)methyl]quinolin-2-one |
|---|---|
| PubChem CID | 139956939 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 7-methoxy-4-(4-methoxyphenyl)-1-[(4-piperidin-4-yloxyphenyl)methyl]quinolin-2-one |
| SMILES | COc1ccc(-c2cc(=O)n(Cc3ccc(OC4CCNCC4)cc3)c3cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C29H30N2O4/c1-33-22-9-5-21(6-10-22)27-18-29(32)31(28-17-25(34-2)11-12-26(27)28)19-20-3-7-23(8-4-20)35-24-13-15-30-16-14-24/h3-12,17-18,24,30H,13-16,19H2,1-2H3 |
| InChIKey | JCWWNQJERHXDIB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |