C52H44N2O6 — CID 164611717
5-[2-(3-methoxyphenyl)ethyl]-9-[4-[5-[2-(3-methoxyphenyl)ethyl]-10-oxoindeno[1,2-b]indol-9-yl]oxybutoxy]indeno[1,2-b]indol-10-one (PubChem CID 164611717) has the molecular formula C52H44N2O6 and a molecular weight of 792.93 g/mol. Its IUPAC name is 5-[2-(3-methoxyphenyl)ethyl]-9-[4-[5-[2-(3-methoxyphenyl)ethyl]-10-oxoindeno[1,2-b]indol-9-yl]oxybutoxy]indeno[1,2-b]indol-10-one.
| Compound Name | 5-[2-(3-methoxyphenyl)ethyl]-9-[4-[5-[2-(3-methoxyphenyl)ethyl]-10-oxoindeno[1,2-b]indol-9-yl]oxybutoxy]indeno[1,2-b]indol-10-one |
|---|---|
| PubChem CID | 164611717 |
| Molecular Formula | C52H44N2O6 |
| Molecular Weight | 792.93 g/mol |
| Exact Mass | 792.32 |
| IUPAC Name | 5-[2-(3-methoxyphenyl)ethyl]-9-[4-[5-[2-(3-methoxyphenyl)ethyl]-10-oxoindeno[1,2-b]indol-9-yl]oxybutoxy]indeno[1,2-b]indol-10-one |
| SMILES | COc1cccc(CCn2c3c(c4c(OCCCCOc5cccc6c5c5c(n6CCc6cccc(OC)c6)-c6ccccc6C5=O)cccc42)C(=O)c2ccccc2-3)c1 |
| InChI | InChI=1S/C52H44N2O6/c1-57-35-15-9-13-33(31-35)25-27-53-41-21-11-23-43(45(41)47-49(53)37-17-3-5-19-39(37)51(47)55)59-29-7-8-30-60-44-24-12-22-42-46(44)48-50(38-18-4-6-20-40(38)52(48)56)54(42)28-26-34-14-10-16-36(32-34)58-2/h3-6,9-24,31-32H,7-8,25-30H2,1-2H3 |
| InChIKey | CRWOJYZPWVKILL-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.93 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|