C16H13NO4 — CID 131857932
3-benzyl-6-methoxy-1,3-benzoxazine-2,4-dione (PubChem CID 131857932) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 3-benzyl-6-methoxy-1,3-benzoxazine-2,4-dione.
| Compound Name | 3-benzyl-6-methoxy-1,3-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 131857932 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-benzyl-6-methoxy-1,3-benzoxazine-2,4-dione |
| SMILES | COc1ccc2oc(=O)n(Cc3ccccc3)c(=O)c2c1 |
| InChI | InChI=1S/C16H13NO4/c1-20-12-7-8-14-13(9-12)15(18)17(16(19)21-14)10-11-5-3-2-4-6-11/h2-9H,10H2,1H3 |
| InChIKey | WZLIDLFOAIWJOD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |