C18H11N3O7 — CID 167070761
(6-benzyl-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl)methyl nitrate (PubChem CID 167070761) has the molecular formula C18H11N3O7 and a molecular weight of 381.30 g/mol. Its IUPAC name is (6-benzyl-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl)methyl nitrate.
| Compound Name | (6-benzyl-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl)methyl nitrate |
|---|---|
| PubChem CID | 167070761 |
| Molecular Formula | C18H11N3O7 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | (6-benzyl-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl)methyl nitrate |
| SMILES | O=c1c2cc3c(=O)n(Cc4ccccc4)c(=O)c3cc2c(=O)n1CO[N+](=O)[O-] |
| InChI | InChI=1S/C18H11N3O7/c22-15-11-6-13-14(18(25)20(17(13)24)9-28-21(26)27)7-12(11)16(23)19(15)8-10-4-2-1-3-5-10/h1-7H,8-9H2 |
| InChIKey | KDEMSXDDLMLEDK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 130.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|