C14H9N5O13 — CID 163300403
[2-(1,3-dinitrooxypropan-2-yl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]methyl nitrate (PubChem CID 163300403) has the molecular formula C14H9N5O13 and a molecular weight of 455.25 g/mol. Its IUPAC name is [2-(1,3-dinitrooxypropan-2-yl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]methyl nitrate.
| Compound Name | [2-(1,3-dinitrooxypropan-2-yl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]methyl nitrate |
|---|---|
| PubChem CID | 163300403 |
| Molecular Formula | C14H9N5O13 |
| Molecular Weight | 455.25 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | [2-(1,3-dinitrooxypropan-2-yl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]methyl nitrate |
| SMILES | O=c1c2cc3c(=O)n(C(CO[N+](=O)[O-])CO[N+](=O)[O-])c(=O)c3cc2c(=O)n1CO[N+](=O)[O-] |
| InChI | InChI=1S/C14H9N5O13/c20-11-7-1-9-10(2-8(7)12(21)15(11)5-32-19(28)29)14(23)16(13(9)22)6(3-30-17(24)25)4-31-18(26)27/h1-2,6H,3-5H2 |
| InChIKey | WWUYUQIIMLISDT-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 235.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.25 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|