C22H30FN3O14P2 — CID 160877743
[6-[2-[[2-[(fluoroamino)methyl]-3-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl]methyl 2-(hydroxymethyl)butyl hydrogen phosphate (PubChem CID 160877743) has the molecular formula C22H30FN3O14P2 and a molecular weight of 641.43 g/mol. Its IUPAC name is [6-[2-[[2-[(fluoroamino)methyl]-3-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl]methyl 2-(hydroxymethyl)butyl hydrogen phosphate.
| Compound Name | [6-[2-[[2-[(fluoroamino)methyl]-3-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl]methyl 2-(hydroxymethyl)butyl hydrogen phosphate |
|---|---|
| PubChem CID | 160877743 |
| Molecular Formula | C22H30FN3O14P2 |
| Molecular Weight | 641.43 g/mol |
| Exact Mass | 641.12 |
| IUPAC Name | [6-[2-[[2-[(fluoroamino)methyl]-3-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl]-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl]methyl 2-(hydroxymethyl)butyl hydrogen phosphate |
| SMILES | CCC(CO)COP(=O)(O)OCn1c(=O)c2cc3c(=O)n(CCOP(=O)(O)OCC(CO)CNF)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C22H30FN3O14P2/c1-2-13(8-27)10-38-42(35,36)40-12-26-21(31)17-5-15-16(6-18(17)22(26)32)20(30)25(19(15)29)3-4-37-41(33,34)39-11-14(9-28)7-24-23/h5-6,13-14,24,27-28H,2-4,7-12H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | SMPVAXWHYNQPOM-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 242.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.43 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|