C14H10N4O10 — CID 163300444
2-[2-(2-nitrooxyethyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]ethyl nitrate (PubChem CID 163300444) has the molecular formula C14H10N4O10 and a molecular weight of 394.25 g/mol. Its IUPAC name is 2-[2-(2-nitrooxyethyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]ethyl nitrate.
| Compound Name | 2-[2-(2-nitrooxyethyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]ethyl nitrate |
|---|---|
| PubChem CID | 163300444 |
| Molecular Formula | C14H10N4O10 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-[2-(2-nitrooxyethyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-6-yl]ethyl nitrate |
| SMILES | O=c1c2cc3c(=O)n(CCO[N+](=O)[O-])c(=O)c3cc2c(=O)n1CCO[N+](=O)[O-] |
| InChI | InChI=1S/C14H10N4O10/c19-11-7-5-9-10(14(22)16(13(9)21)2-4-28-18(25)26)6-8(7)12(20)15(11)1-3-27-17(23)24/h5-6H,1-4H2 |
| InChIKey | LDYUAUUQYVWYGJ-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 182.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|