About phenylmethoxymethyl nitrate
phenylmethoxymethyl nitrate (PubChem CID 152715822) has the molecular formula C8H9NO4
and a molecular weight of 183.16 g/mol. Its IUPAC name is phenylmethoxymethyl nitrate.
Molecular Properties
| Compound Name | phenylmethoxymethyl nitrate |
| PubChem CID | 152715822 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | phenylmethoxymethyl nitrate |
| SMILES | O=[N+]([O-])OCOCc1ccccc1 |
| InChI | InChI=1S/C8H9NO4/c10-9(11)13-7-12-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | ZUOQTHSOMSZLRU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phenylmethoxymethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethoxymethyl nitrate?
The IUPAC name of phenylmethoxymethyl nitrate (CID 152715822) is phenylmethoxymethyl nitrate.
What is the SMILES notation for phenylmethoxymethyl nitrate?
The canonical SMILES for phenylmethoxymethyl nitrate is O=[N+]([O-])OCOCc1ccccc1.
What is the InChIKey of phenylmethoxymethyl nitrate?
The InChIKey is ZUOQTHSOMSZLRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4/c10-9(11)13-7-12-6-8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of phenylmethoxymethyl nitrate?
phenylmethoxymethyl nitrate has a molecular weight of 183.16 g/mol, XLogP of 1.37, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethoxymethyl nitrate is sourced from PubChem (CID 152715822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).