C24H19N3O6S — CID 134096545
2-(1,4-dibenzyl-7-nitro-2,3-dioxoquinoxalin-6-yl)sulfanylacetic acid (PubChem CID 134096545) has the molecular formula C24H19N3O6S and a molecular weight of 477.50 g/mol. Its IUPAC name is 2-(1,4-dibenzyl-7-nitro-2,3-dioxoquinoxalin-6-yl)sulfanylacetic acid.
| Compound Name | 2-(1,4-dibenzyl-7-nitro-2,3-dioxoquinoxalin-6-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 134096545 |
| Molecular Formula | C24H19N3O6S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 2-(1,4-dibenzyl-7-nitro-2,3-dioxoquinoxalin-6-yl)sulfanylacetic acid |
| SMILES | O=C(O)CSc1cc2c(cc1[N+](=O)[O-])n(Cc1ccccc1)c(=O)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C24H19N3O6S/c28-22(29)15-34-21-12-19-18(11-20(21)27(32)33)25(13-16-7-3-1-4-8-16)23(30)24(31)26(19)14-17-9-5-2-6-10-17/h1-12H,13-15H2,(H,28,29) |
| InChIKey | UUYOSJFKVWXUDJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|