C23H17N3O4 — CID 141232872
1-benzyl-2,5-bis(2-nitrophenyl)pyrrole (PubChem CID 141232872) has the molecular formula C23H17N3O4 and a molecular weight of 399.41 g/mol. Its IUPAC name is 1-benzyl-2,5-bis(2-nitrophenyl)pyrrole.
| Compound Name | 1-benzyl-2,5-bis(2-nitrophenyl)pyrrole |
|---|---|
| PubChem CID | 141232872 |
| Molecular Formula | C23H17N3O4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1-benzyl-2,5-bis(2-nitrophenyl)pyrrole |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccc(-c2ccccc2[N+](=O)[O-])n1Cc1ccccc1 |
| InChI | InChI=1S/C23H17N3O4/c27-25(28)22-12-6-4-10-18(22)20-14-15-21(19-11-5-7-13-23(19)26(29)30)24(20)16-17-8-2-1-3-9-17/h1-15H,16H2 |
| InChIKey | HWSJMQRHVDMZKL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 91.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|