C11H8Br3N — CID 12713073
1-benzyl-2,3,5-tribromopyrrole (PubChem CID 12713073) has the molecular formula C11H8Br3N and a molecular weight of 393.90 g/mol. Its IUPAC name is 1-benzyl-2,3,5-tribromopyrrole.
| Compound Name | 1-benzyl-2,3,5-tribromopyrrole |
|---|---|
| PubChem CID | 12713073 |
| Molecular Formula | C11H8Br3N |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 390.82 |
| IUPAC Name | 1-benzyl-2,3,5-tribromopyrrole |
| SMILES | Brc1cc(Br)n(Cc2ccccc2)c1Br |
| InChI | InChI=1S/C11H8Br3N/c12-9-6-10(13)15(11(9)14)7-8-4-2-1-3-5-8/h1-6H,7H2 |
| InChIKey | RAQQKGVHENDQEQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |